C14H21FN2O4 — CID 124888440
1-[4-fluoro-2-(methoxymethyl)phenyl]-3-[(2R)-1-hydroxy-4-methoxybutan-2-yl]urea (PubChem CID 124888440) has the molecular formula C14H21FN2O4 and a molecular weight of 300.33 g/mol. Its IUPAC name is 1-[4-fluoro-2-(methoxymethyl)phenyl]-3-[(2R)-1-hydroxy-4-methoxybutan-2-yl]urea.
| Compound Name | 1-[4-fluoro-2-(methoxymethyl)phenyl]-3-[(2R)-1-hydroxy-4-methoxybutan-2-yl]urea |
|---|---|
| PubChem CID | 124888440 |
| Molecular Formula | C14H21FN2O4 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1-[4-fluoro-2-(methoxymethyl)phenyl]-3-[(2R)-1-hydroxy-4-methoxybutan-2-yl]urea |
| SMILES | COCC[C@H](CO)NC(=O)Nc1ccc(F)cc1COC |
| InChI | InChI=1S/C14H21FN2O4/c1-20-6-5-12(8-18)16-14(19)17-13-4-3-11(15)7-10(13)9-21-2/h3-4,7,12,18H,5-6,8-9H2,1-2H3,(H2,16,17,19)/t12-/m1/s1 |
| InChIKey | WNWXORIXBVSYEL-GFCCVEGCSA-N |
| XLogP | 1.49 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |