C12H14ClFN2O4 — CID 107530131
2-[(2-chloro-5-fluorophenyl)carbamoylamino]-4-methoxybutanoic acid (PubChem CID 107530131) has the molecular formula C12H14ClFN2O4 and a molecular weight of 304.71 g/mol. Its IUPAC name is 2-[(2-chloro-5-fluorophenyl)carbamoylamino]-4-methoxybutanoic acid.
| Compound Name | 2-[(2-chloro-5-fluorophenyl)carbamoylamino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 107530131 |
| Molecular Formula | C12H14ClFN2O4 |
| Molecular Weight | 304.71 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[(2-chloro-5-fluorophenyl)carbamoylamino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)Nc1cc(F)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C12H14ClFN2O4/c1-20-5-4-9(11(17)18)15-12(19)16-10-6-7(14)2-3-8(10)13/h2-3,6,9H,4-5H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | KOISYRCZGYBTPZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.71 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |