C12H10ClFN2O3 — CID 107529915
2-[(2-chloro-5-fluorophenyl)carbamoylamino]pent-4-ynoic acid (PubChem CID 107529915) has the molecular formula C12H10ClFN2O3 and a molecular weight of 284.67 g/mol. Its IUPAC name is 2-[(2-chloro-5-fluorophenyl)carbamoylamino]pent-4-ynoic acid.
| Compound Name | 2-[(2-chloro-5-fluorophenyl)carbamoylamino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 107529915 |
| Molecular Formula | C12H10ClFN2O3 |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-[(2-chloro-5-fluorophenyl)carbamoylamino]pent-4-ynoic acid |
| SMILES | C#CCC(NC(=O)Nc1cc(F)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C12H10ClFN2O3/c1-2-3-9(11(17)18)15-12(19)16-10-6-7(14)4-5-8(10)13/h1,4-6,9H,3H2,(H,17,18)(H2,15,16,19) |
| InChIKey | ABVJMIZDNAHQSL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|