C14H23N3O3S2 — CID 119051482
N-[(5-ethylthiophen-2-yl)methyl]-4-(sulfamoylmethyl)piperidine-1-carboxamide (PubChem CID 119051482) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[(5-ethylthiophen-2-yl)methyl]-4-(sulfamoylmethyl)piperidine-1-carboxamide.
| Compound Name | N-[(5-ethylthiophen-2-yl)methyl]-4-(sulfamoylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 119051482 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-[(5-ethylthiophen-2-yl)methyl]-4-(sulfamoylmethyl)piperidine-1-carboxamide |
| SMILES | CCc1ccc(CNC(=O)N2CCC(CS(N)(=O)=O)CC2)s1 |
| InChI | InChI=1S/C14H23N3O3S2/c1-2-12-3-4-13(21-12)9-16-14(18)17-7-5-11(6-8-17)10-22(15,19)20/h3-4,11H,2,5-10H2,1H3,(H,16,18)(H2,15,19,20) |
| InChIKey | WPVJGFNWIMMFSP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |