C12H16N2O3S — CID 106005643
1-[(5-ethylthiophen-2-yl)methylcarbamoyl]azetidine-3-carboxylic acid (PubChem CID 106005643) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)methylcarbamoyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[(5-ethylthiophen-2-yl)methylcarbamoyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 106005643 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)methylcarbamoyl]azetidine-3-carboxylic acid |
| SMILES | CCc1ccc(CNC(=O)N2CC(C(=O)O)C2)s1 |
| InChI | InChI=1S/C12H16N2O3S/c1-2-9-3-4-10(18-9)5-13-12(17)14-6-8(7-14)11(15)16/h3-4,8H,2,5-7H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | HDPGGSAGDXOMSI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |