C15H26N2O4S2 — CID 52519602
(2S)-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-2-(3-methylbutoxy)propanamide (PubChem CID 52519602) has the molecular formula C15H26N2O4S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is (2S)-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-2-(3-methylbutoxy)propanamide.
| Compound Name | (2S)-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-2-(3-methylbutoxy)propanamide |
|---|---|
| PubChem CID | 52519602 |
| Molecular Formula | C15H26N2O4S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (2S)-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-2-(3-methylbutoxy)propanamide |
| SMILES | CC(C)CCO[C@@H](C)C(=O)NCc1ccc(S(=O)(=O)N(C)C)s1 |
| InChI | InChI=1S/C15H26N2O4S2/c1-11(2)8-9-21-12(3)15(18)16-10-13-6-7-14(22-13)23(19,20)17(4)5/h6-7,11-12H,8-10H2,1-5H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | CXUKNKITEYLWRW-LBPRGKRZSA-N |
| XLogP | 2.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |