C13H20N2O4S2 — CID 103164410
2-(3-ethoxycyclobutyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide (PubChem CID 103164410) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-(3-ethoxycyclobutyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(3-ethoxycyclobutyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 103164410 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-(3-ethoxycyclobutyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide |
| SMILES | CCOC1CC(CC(=O)NCc2ccc(S(N)(=O)=O)s2)C1 |
| InChI | InChI=1S/C13H20N2O4S2/c1-2-19-10-5-9(6-10)7-12(16)15-8-11-3-4-13(20-11)21(14,17)18/h3-4,9-10H,2,5-8H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | WDALKSQKZXAGGU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |