C14H14F2N2O2 — CID 167991621
cis-(1S,2S)-2-fluoro-N-[2-fluoro-5-[(prop-2-enoylamino)methyl]phenyl]cyclopropane-1-carboxamide (PubChem CID 167991621) has the molecular formula C14H14F2N2O2 and a molecular weight of 280.27 g/mol. Its IUPAC name is cis-(1S,2S)-2-fluoro-N-[2-fluoro-5-[(prop-2-enoylamino)methyl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-2-fluoro-N-[2-fluoro-5-[(prop-2-enoylamino)methyl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 167991621 |
| Molecular Formula | C14H14F2N2O2 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | cis-(1S,2S)-2-fluoro-N-[2-fluoro-5-[(prop-2-enoylamino)methyl]phenyl]cyclopropane-1-carboxamide |
| SMILES | C=CC(=O)NCc1ccc(F)c(NC(=O)[C@@H]2C[C@@H]2F)c1 |
| InChI | InChI=1S/C14H14F2N2O2/c1-2-13(19)17-7-8-3-4-10(15)12(5-8)18-14(20)9-6-11(9)16/h2-5,9,11H,1,6-7H2,(H,17,19)(H,18,20)/t9-,11+/m1/s1 |
| InChIKey | UBIGWOLIFBOBMD-KOLCDFICSA-N |
| XLogP | 1.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|