C22H26N2O2 — CID 166422255
N-[1-(2,5-dimethylphenyl)propyl]-2-[(prop-2-enoylamino)methyl]benzamide (PubChem CID 166422255) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-[1-(2,5-dimethylphenyl)propyl]-2-[(prop-2-enoylamino)methyl]benzamide.
| Compound Name | N-[1-(2,5-dimethylphenyl)propyl]-2-[(prop-2-enoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 166422255 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-[1-(2,5-dimethylphenyl)propyl]-2-[(prop-2-enoylamino)methyl]benzamide |
| SMILES | C=CC(=O)NCc1ccccc1C(=O)NC(CC)c1cc(C)ccc1C |
| InChI | InChI=1S/C22H26N2O2/c1-5-20(19-13-15(3)11-12-16(19)4)24-22(26)18-10-8-7-9-17(18)14-23-21(25)6-2/h6-13,20H,2,5,14H2,1,3-4H3,(H,23,25)(H,24,26) |
| InChIKey | ACXLQPPYJGEAJI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|