C20H21ClN2O2 — CID 166422248
N-[3-(4-chlorophenyl)propyl]-2-[(prop-2-enoylamino)methyl]benzamide (PubChem CID 166422248) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)propyl]-2-[(prop-2-enoylamino)methyl]benzamide.
| Compound Name | N-[3-(4-chlorophenyl)propyl]-2-[(prop-2-enoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 166422248 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[3-(4-chlorophenyl)propyl]-2-[(prop-2-enoylamino)methyl]benzamide |
| SMILES | C=CC(=O)NCc1ccccc1C(=O)NCCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O2/c1-2-19(24)23-14-16-7-3-4-8-18(16)20(25)22-13-5-6-15-9-11-17(21)12-10-15/h2-4,7-12H,1,5-6,13-14H2,(H,22,25)(H,23,24) |
| InChIKey | YVFSMLPZNLCZRY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|