C19H20ClNO3S — CID 119183491
2-[2-[3-(4-chlorophenyl)propylcarbamoyl]phenyl]sulfanylpropanoic acid (PubChem CID 119183491) has the molecular formula C19H20ClNO3S and a molecular weight of 377.89 g/mol. Its IUPAC name is 2-[2-[3-(4-chlorophenyl)propylcarbamoyl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-[3-(4-chlorophenyl)propylcarbamoyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 119183491 |
| Molecular Formula | C19H20ClNO3S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[2-[3-(4-chlorophenyl)propylcarbamoyl]phenyl]sulfanylpropanoic acid |
| SMILES | CC(Sc1ccccc1C(=O)NCCCc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C19H20ClNO3S/c1-13(19(23)24)25-17-7-3-2-6-16(17)18(22)21-12-4-5-14-8-10-15(20)11-9-14/h2-3,6-11,13H,4-5,12H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | XRGDQIKOFOEWHK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|