C13H18N2O5S2 — CID 119184470
2-[2-[2-(methanesulfonamido)ethylcarbamoyl]phenyl]sulfanylpropanoic acid (PubChem CID 119184470) has the molecular formula C13H18N2O5S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[2-[2-(methanesulfonamido)ethylcarbamoyl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-[2-(methanesulfonamido)ethylcarbamoyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 119184470 |
| Molecular Formula | C13H18N2O5S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-[2-[2-(methanesulfonamido)ethylcarbamoyl]phenyl]sulfanylpropanoic acid |
| SMILES | CC(Sc1ccccc1C(=O)NCCNS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C13H18N2O5S2/c1-9(13(17)18)21-11-6-4-3-5-10(11)12(16)14-7-8-15-22(2,19)20/h3-6,9,15H,7-8H2,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | UGYDDFWPCPZGQM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|