C20H17ClN2O3 — CID 166422205
N-[(2-chloro-1-benzofuran-3-yl)methyl]-2-[(prop-2-enoylamino)methyl]benzamide (PubChem CID 166422205) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is N-[(2-chloro-1-benzofuran-3-yl)methyl]-2-[(prop-2-enoylamino)methyl]benzamide.
| Compound Name | N-[(2-chloro-1-benzofuran-3-yl)methyl]-2-[(prop-2-enoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 166422205 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[(2-chloro-1-benzofuran-3-yl)methyl]-2-[(prop-2-enoylamino)methyl]benzamide |
| SMILES | C=CC(=O)NCc1ccccc1C(=O)NCc1c(Cl)oc2ccccc12 |
| InChI | InChI=1S/C20H17ClN2O3/c1-2-18(24)22-11-13-7-3-4-8-14(13)20(25)23-12-16-15-9-5-6-10-17(15)26-19(16)21/h2-10H,1,11-12H2,(H,22,24)(H,23,25) |
| InChIKey | CFXHLEQLUJFVHB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|