C13H14ClNO2 — CID 143612119
N-[(3-methyl-1-benzofuran-2-yl)methyl]prop-2-enamide;hydrochloride (PubChem CID 143612119) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is N-[(3-methyl-1-benzofuran-2-yl)methyl]prop-2-enamide;hydrochloride.
| Compound Name | N-[(3-methyl-1-benzofuran-2-yl)methyl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 143612119 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-[(3-methyl-1-benzofuran-2-yl)methyl]prop-2-enamide;hydrochloride |
| SMILES | C=CC(=O)NCc1oc2ccccc2c1C.Cl |
| InChI | InChI=1S/C13H13NO2.ClH/c1-3-13(15)14-8-12-9(2)10-6-4-5-7-11(10)16-12;/h3-7H,1,8H2,2H3,(H,14,15);1H |
| InChIKey | ZOVIUEBUYUOFLS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|