C19H23OP — CID 154266689
[phenyl(propan-2-yl)phosphanyl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 154266689) has the molecular formula C19H23OP and a molecular weight of 298.37 g/mol. Its IUPAC name is [phenyl(propan-2-yl)phosphanyl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [phenyl(propan-2-yl)phosphanyl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 154266689 |
| Molecular Formula | C19H23OP |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | [phenyl(propan-2-yl)phosphanyl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(c2ccccc2)C(C)C)c(C)c1 |
| InChI | InChI=1S/C19H23OP/c1-13(2)21(17-9-7-6-8-10-17)19(20)18-15(4)11-14(3)12-16(18)5/h6-13H,1-5H3 |
| InChIKey | ISOGAFPNWCGENN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|