C20H25O2P — CID 154349504
3-[ethyl(phenyl)phosphanyl]oxy-1-(2,4,6-trimethylphenyl)propan-1-one (PubChem CID 154349504) has the molecular formula C20H25O2P and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-[ethyl(phenyl)phosphanyl]oxy-1-(2,4,6-trimethylphenyl)propan-1-one.
| Compound Name | 3-[ethyl(phenyl)phosphanyl]oxy-1-(2,4,6-trimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 154349504 |
| Molecular Formula | C20H25O2P |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 3-[ethyl(phenyl)phosphanyl]oxy-1-(2,4,6-trimethylphenyl)propan-1-one |
| SMILES | CCP(OCCC(=O)c1c(C)cc(C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C20H25O2P/c1-5-23(18-9-7-6-8-10-18)22-12-11-19(21)20-16(3)13-15(2)14-17(20)4/h6-10,13-14H,5,11-12H2,1-4H3 |
| InChIKey | PUKPVZOUDBKSMB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|