C25H35OP — CID 154395380
[benzyl(2,4,4-trimethylpentyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 154395380) has the molecular formula C25H35OP and a molecular weight of 382.53 g/mol. Its IUPAC name is [benzyl(2,4,4-trimethylpentyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [benzyl(2,4,4-trimethylpentyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 154395380 |
| Molecular Formula | C25H35OP |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | [benzyl(2,4,4-trimethylpentyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(Cc2ccccc2)CC(C)CC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C25H35OP/c1-18-13-20(3)23(21(4)14-18)24(26)27(16-19(2)15-25(5,6)7)17-22-11-9-8-10-12-22/h8-14,19H,15-17H2,1-7H3 |
| InChIKey | BUUXUVQRLWTXCX-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|