C19H30O — CID 114966057
4,6,6-trimethyl-1-(2,4,6-trimethylphenyl)heptan-2-one (PubChem CID 114966057) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 4,6,6-trimethyl-1-(2,4,6-trimethylphenyl)heptan-2-one.
| Compound Name | 4,6,6-trimethyl-1-(2,4,6-trimethylphenyl)heptan-2-one |
|---|---|
| PubChem CID | 114966057 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 4,6,6-trimethyl-1-(2,4,6-trimethylphenyl)heptan-2-one |
| SMILES | Cc1cc(C)c(CC(=O)CC(C)CC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C19H30O/c1-13-8-15(3)18(16(4)9-13)11-17(20)10-14(2)12-19(5,6)7/h8-9,14H,10-12H2,1-7H3 |
| InChIKey | QISWRHGTIZPRAL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |