C16H24O2 — CID 71365800
1-(2-hydroxy-4-methylphenyl)-3,5,5-trimethylhexan-1-one (PubChem CID 71365800) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(2-hydroxy-4-methylphenyl)-3,5,5-trimethylhexan-1-one.
| Compound Name | 1-(2-hydroxy-4-methylphenyl)-3,5,5-trimethylhexan-1-one |
|---|---|
| PubChem CID | 71365800 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-(2-hydroxy-4-methylphenyl)-3,5,5-trimethylhexan-1-one |
| SMILES | Cc1ccc(C(=O)CC(C)CC(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C16H24O2/c1-11-6-7-13(14(17)8-11)15(18)9-12(2)10-16(3,4)5/h6-8,12,17H,9-10H2,1-5H3 |
| InChIKey | NPQHNTRFYGQDOY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |