C22H28O — CID 146007423
3,5,5-trimethyl-1-(2-methyl-3-phenylphenyl)hexan-1-one (PubChem CID 146007423) has the molecular formula C22H28O and a molecular weight of 308.46 g/mol. Its IUPAC name is 3,5,5-trimethyl-1-(2-methyl-3-phenylphenyl)hexan-1-one.
| Compound Name | 3,5,5-trimethyl-1-(2-methyl-3-phenylphenyl)hexan-1-one |
|---|---|
| PubChem CID | 146007423 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 3,5,5-trimethyl-1-(2-methyl-3-phenylphenyl)hexan-1-one |
| SMILES | Cc1c(C(=O)CC(C)CC(C)(C)C)cccc1-c1ccccc1 |
| InChI | InChI=1S/C22H28O/c1-16(15-22(3,4)5)14-21(23)20-13-9-12-19(17(20)2)18-10-7-6-8-11-18/h6-13,16H,14-15H2,1-5H3 |
| InChIKey | JNAKUSSOEWMGIJ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |