C16H14F3NO3 — CID 67159928
2-methyl-3-phenylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 67159928) has the molecular formula C16H14F3NO3 and a molecular weight of 325.29 g/mol. Its IUPAC name is 2-methyl-3-phenylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-methyl-3-phenylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67159928 |
| Molecular Formula | C16H14F3NO3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-methyl-3-phenylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1c(C(N)=O)cccc1-c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H13NO.C2HF3O2/c1-10-12(11-6-3-2-4-7-11)8-5-9-13(10)14(15)16;3-2(4,5)1(6)7/h2-9H,1H3,(H2,15,16);(H,6,7) |
| InChIKey | CFIURPRRMLTZML-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |