C13H15ClO3 — CID 146004305
5-(3-chloro-2-methylphenyl)-3-methyl-5-oxopentanoic acid (PubChem CID 146004305) has the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. Its IUPAC name is 5-(3-chloro-2-methylphenyl)-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-(3-chloro-2-methylphenyl)-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 146004305 |
| Molecular Formula | C13H15ClO3 |
| Molecular Weight | 254.71 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 5-(3-chloro-2-methylphenyl)-3-methyl-5-oxopentanoic acid |
| SMILES | Cc1c(Cl)cccc1C(=O)CC(C)CC(=O)O |
| InChI | InChI=1S/C13H15ClO3/c1-8(7-13(16)17)6-12(15)10-4-3-5-11(14)9(10)2/h3-5,8H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | AYQMLDDXDSFZJT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.71 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |