C18H28LiOP — CID 58752987
lithium (2,4,6-trimethylbenzoyl)-(2,4,4-trimethylpentyl)phosphanide (PubChem CID 58752987) has the molecular formula C18H28LiOP and a molecular weight of 298.34 g/mol. Its IUPAC name is lithium (2,4,6-trimethylbenzoyl)-(2,4,4-trimethylpentyl)phosphanide.
| Compound Name | lithium (2,4,6-trimethylbenzoyl)-(2,4,4-trimethylpentyl)phosphanide |
|---|---|
| PubChem CID | 58752987 |
| Molecular Formula | C18H28LiOP |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | lithium (2,4,6-trimethylbenzoyl)-(2,4,4-trimethylpentyl)phosphanide |
| SMILES | Cc1cc(C)c(C(=O)[P-]CC(C)CC(C)(C)C)c(C)c1.[Li+] |
| InChI | InChI=1S/C18H28OP.Li/c1-12-8-14(3)16(15(4)9-12)17(19)20-11-13(2)10-18(5,6)7;/h8-9,13H,10-11H2,1-7H3;/q-1;+1 |
| InChIKey | TXXATIVJMZHOPE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|