C24H40O4P+ — CID 162162036
butyl 4,6,6-trimethyl-2-(2,4,6-trimethylbenzoyl)heptanoate;oxophosphanium (PubChem CID 162162036) has the molecular formula C24H40O4P+ and a molecular weight of 423.55 g/mol. Its IUPAC name is butyl 4,6,6-trimethyl-2-(2,4,6-trimethylbenzoyl)heptanoate;oxophosphanium.
| Compound Name | butyl 4,6,6-trimethyl-2-(2,4,6-trimethylbenzoyl)heptanoate;oxophosphanium |
|---|---|
| PubChem CID | 162162036 |
| Molecular Formula | C24H40O4P+ |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | butyl 4,6,6-trimethyl-2-(2,4,6-trimethylbenzoyl)heptanoate;oxophosphanium |
| SMILES | CCCCOC(=O)C(CC(C)CC(C)(C)C)C(=O)c1c(C)cc(C)cc1C.O=[PH2+] |
| InChI | InChI=1S/C24H38O3.H2OP/c1-9-10-11-27-23(26)20(14-17(3)15-24(6,7)8)22(25)21-18(4)12-16(2)13-19(21)5;1-2/h12-13,17,20H,9-11,14-15H2,1-8H3;2H2/q;+1 |
| InChIKey | IRDGJBPIGWIMLJ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|