C22H34O5 — CID 22183569
propyl 2-(2,6-dimethoxybenzoyl)-4,6,6-trimethylheptanoate (PubChem CID 22183569) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is propyl 2-(2,6-dimethoxybenzoyl)-4,6,6-trimethylheptanoate.
| Compound Name | propyl 2-(2,6-dimethoxybenzoyl)-4,6,6-trimethylheptanoate |
|---|---|
| PubChem CID | 22183569 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | propyl 2-(2,6-dimethoxybenzoyl)-4,6,6-trimethylheptanoate |
| SMILES | CCCOC(=O)C(CC(C)CC(C)(C)C)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C22H34O5/c1-8-12-27-21(24)16(13-15(2)14-22(3,4)5)20(23)19-17(25-6)10-9-11-18(19)26-7/h9-11,15-16H,8,12-14H2,1-7H3 |
| InChIKey | YOVDOJDBOPWWED-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|