C22H34O3 — CID 22183690
ethyl 4,6,6-trimethyl-2-(2,4,6-trimethylbenzoyl)heptanoate (PubChem CID 22183690) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is ethyl 4,6,6-trimethyl-2-(2,4,6-trimethylbenzoyl)heptanoate.
| Compound Name | ethyl 4,6,6-trimethyl-2-(2,4,6-trimethylbenzoyl)heptanoate |
|---|---|
| PubChem CID | 22183690 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | ethyl 4,6,6-trimethyl-2-(2,4,6-trimethylbenzoyl)heptanoate |
| SMILES | CCOC(=O)C(CC(C)CC(C)(C)C)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C22H34O3/c1-9-25-21(24)18(12-15(3)13-22(6,7)8)20(23)19-16(4)10-14(2)11-17(19)5/h10-11,15,18H,9,12-13H2,1-8H3 |
| InChIKey | OJEQRMWPCFOTPH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|