C24H40O2P+ — CID 173194779
oxo-(2,4,6-trimethylbenzoyl)-(2,2,4-trimethylundecan-6-yl)phosphanium (PubChem CID 173194779) has the molecular formula C24H40O2P+ and a molecular weight of 391.56 g/mol. Its IUPAC name is oxo-(2,4,6-trimethylbenzoyl)-(2,2,4-trimethylundecan-6-yl)phosphanium.
| Compound Name | oxo-(2,4,6-trimethylbenzoyl)-(2,2,4-trimethylundecan-6-yl)phosphanium |
|---|---|
| PubChem CID | 173194779 |
| Molecular Formula | C24H40O2P+ |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | oxo-(2,4,6-trimethylbenzoyl)-(2,2,4-trimethylundecan-6-yl)phosphanium |
| SMILES | CCCCCC(CC(C)CC(C)(C)C)[P+](=O)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H40O2P/c1-9-10-11-12-21(15-18(3)16-24(6,7)8)27(26)23(25)22-19(4)13-17(2)14-20(22)5/h13-14,18,21H,9-12,15-16H2,1-8H3/q+1 |
| InChIKey | GTSJWDITABUPPF-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|