C22H37O2P — CID 22183774
[tert-butyl(2,4,4-trimethylpentyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 22183774) has the molecular formula C22H37O2P and a molecular weight of 364.51 g/mol. Its IUPAC name is [tert-butyl(2,4,4-trimethylpentyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [tert-butyl(2,4,4-trimethylpentyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 22183774 |
| Molecular Formula | C22H37O2P |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | [tert-butyl(2,4,4-trimethylpentyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(CC(C)CC(C)(C)C)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C22H37O2P/c1-15-11-17(3)19(18(4)12-15)20(23)25(24,22(8,9)10)14-16(2)13-21(5,6)7/h11-12,16H,13-14H2,1-10H3 |
| InChIKey | KYLKUXCKHIWPHM-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|