C40H51OP — CID 152721389
1,3,5-trimethyl-2-[phenyl-[[phenyl-(2,4,6-trimethylphenyl)methyl]-(2,4,4-trimethylpentyl)phosphoryl]methyl]benzene (PubChem CID 152721389) has the molecular formula C40H51OP and a molecular weight of 578.82 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-[phenyl-[[phenyl-(2,4,6-trimethylphenyl)methyl]-(2,4,4-trimethylpentyl)phosphoryl]methyl]benzene.
| Compound Name | 1,3,5-trimethyl-2-[phenyl-[[phenyl-(2,4,6-trimethylphenyl)methyl]-(2,4,4-trimethylpentyl)phosphoryl]methyl]benzene |
|---|---|
| PubChem CID | 152721389 |
| Molecular Formula | C40H51OP |
| Molecular Weight | 578.82 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | 1,3,5-trimethyl-2-[phenyl-[[phenyl-(2,4,6-trimethylphenyl)methyl]-(2,4,4-trimethylpentyl)phosphoryl]methyl]benzene |
| SMILES | Cc1cc(C)c(C(c2ccccc2)P(=O)(CC(C)CC(C)(C)C)C(c2ccccc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C40H51OP/c1-27-21-30(4)36(31(5)22-27)38(34-17-13-11-14-18-34)42(41,26-29(3)25-40(8,9)10)39(35-19-15-12-16-20-35)37-32(6)23-28(2)24-33(37)7/h11-24,29,38-39H,25-26H2,1-10H3 |
| InChIKey | ZVRYYAUKTFPCAJ-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.82 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|