C46H55O3P — CID 150223041
2-[[(2,4-dibutoxyphenyl)-[phenyl-(2,4,6-trimethylphenyl)methyl]phosphoryl]-phenylmethyl]-1,3,5-trimethylbenzene (PubChem CID 150223041) has the molecular formula C46H55O3P and a molecular weight of 686.92 g/mol. Its IUPAC name is 2-[[(2,4-dibutoxyphenyl)-[phenyl-(2,4,6-trimethylphenyl)methyl]phosphoryl]-phenylmethyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[[(2,4-dibutoxyphenyl)-[phenyl-(2,4,6-trimethylphenyl)methyl]phosphoryl]-phenylmethyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 150223041 |
| Molecular Formula | C46H55O3P |
| Molecular Weight | 686.92 g/mol |
| Exact Mass | 686.39 |
| IUPAC Name | 2-[[(2,4-dibutoxyphenyl)-[phenyl-(2,4,6-trimethylphenyl)methyl]phosphoryl]-phenylmethyl]-1,3,5-trimethylbenzene |
| SMILES | CCCCOc1ccc(P(=O)(C(c2ccccc2)c2c(C)cc(C)cc2C)C(c2ccccc2)c2c(C)cc(C)cc2C)c(OCCCC)c1 |
| InChI | InChI=1S/C46H55O3P/c1-9-11-25-48-40-23-24-42(41(31-40)49-26-12-10-2)50(47,45(38-19-15-13-16-20-38)43-34(5)27-32(3)28-35(43)6)46(39-21-17-14-18-22-39)44-36(7)29-33(4)30-37(44)8/h13-24,27-31,45-46H,9-12,25-26H2,1-8H3 |
| InChIKey | FTWTUOXIVVEMHM-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.92 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|