C26H36O4P+ — CID 66605933
(2,4-dipentoxyphenyl)-oxo-(2,4,6-trimethylbenzoyl)phosphanium (PubChem CID 66605933) has the molecular formula C26H36O4P+ and a molecular weight of 443.54 g/mol. Its IUPAC name is (2,4-dipentoxyphenyl)-oxo-(2,4,6-trimethylbenzoyl)phosphanium.
| Compound Name | (2,4-dipentoxyphenyl)-oxo-(2,4,6-trimethylbenzoyl)phosphanium |
|---|---|
| PubChem CID | 66605933 |
| Molecular Formula | C26H36O4P+ |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (2,4-dipentoxyphenyl)-oxo-(2,4,6-trimethylbenzoyl)phosphanium |
| SMILES | CCCCCOc1ccc([P+](=O)C(=O)c2c(C)cc(C)cc2C)c(OCCCCC)c1 |
| InChI | InChI=1S/C26H36O4P/c1-6-8-10-14-29-22-12-13-24(23(18-22)30-15-11-9-7-2)31(28)26(27)25-20(4)16-19(3)17-21(25)5/h12-13,16-18H,6-11,14-15H2,1-5H3/q+1 |
| InChIKey | BIUZPSHBNHRNOZ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|