C34H43O6P — CID 159387722
[(2,4-dibutoxyphenoxy)-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 159387722) has the molecular formula C34H43O6P and a molecular weight of 578.69 g/mol. Its IUPAC name is [(2,4-dibutoxyphenoxy)-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [(2,4-dibutoxyphenoxy)-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 159387722 |
| Molecular Formula | C34H43O6P |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | [(2,4-dibutoxyphenoxy)-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCCCOc1ccc(OP(=O)(C(=O)c2c(C)cc(C)cc2C)C(=O)c2c(C)cc(C)cc2C)c(OCCCC)c1 |
| InChI | InChI=1S/C34H43O6P/c1-9-11-15-38-28-13-14-29(30(21-28)39-16-12-10-2)40-41(37,33(35)31-24(5)17-22(3)18-25(31)6)34(36)32-26(7)19-23(4)20-27(32)8/h13-14,17-21H,9-12,15-16H2,1-8H3 |
| InChIKey | LLSFNYTVHONUCL-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|