C25H35O3P — CID 18513750
(2,4-dibutoxyphenyl)phosphanyl-(2,3,4,6-tetramethylphenyl)methanone (PubChem CID 18513750) has the molecular formula C25H35O3P and a molecular weight of 414.53 g/mol. Its IUPAC name is (2,4-dibutoxyphenyl)phosphanyl-(2,3,4,6-tetramethylphenyl)methanone.
| Compound Name | (2,4-dibutoxyphenyl)phosphanyl-(2,3,4,6-tetramethylphenyl)methanone |
|---|---|
| PubChem CID | 18513750 |
| Molecular Formula | C25H35O3P |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (2,4-dibutoxyphenyl)phosphanyl-(2,3,4,6-tetramethylphenyl)methanone |
| SMILES | CCCCOc1ccc(PC(=O)c2c(C)cc(C)c(C)c2C)c(OCCCC)c1 |
| InChI | InChI=1S/C25H35O3P/c1-7-9-13-27-21-11-12-23(22(16-21)28-14-10-8-2)29-25(26)24-18(4)15-17(3)19(5)20(24)6/h11-12,15-16,29H,7-10,13-14H2,1-6H3 |
| InChIKey | ILMCUFLERQKZEL-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|