C33H52LiO3P — CID 173243207
lithium;[2,4-bis(2-ethylhexoxy)phenyl]phosphanyl-(2,3,4,6-tetramethylphenyl)methanone;hydride (PubChem CID 173243207) has the molecular formula C33H52LiO3P and a molecular weight of 534.69 g/mol. Its IUPAC name is lithium;[2,4-bis(2-ethylhexoxy)phenyl]phosphanyl-(2,3,4,6-tetramethylphenyl)methanone;hydride.
| Compound Name | lithium;[2,4-bis(2-ethylhexoxy)phenyl]phosphanyl-(2,3,4,6-tetramethylphenyl)methanone;hydride |
|---|---|
| PubChem CID | 173243207 |
| Molecular Formula | C33H52LiO3P |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.38 |
| IUPAC Name | lithium;[2,4-bis(2-ethylhexoxy)phenyl]phosphanyl-(2,3,4,6-tetramethylphenyl)methanone;hydride |
| SMILES | CCCCC(CC)COc1ccc(PC(=O)c2c(C)cc(C)c(C)c2C)c(OCC(CC)CCCC)c1.[H-].[Li+] |
| InChI | InChI=1S/C33H51O3P.Li.H/c1-9-13-15-27(11-3)21-35-29-17-18-31(30(20-29)36-22-28(12-4)16-14-10-2)37-33(34)32-24(6)19-23(5)25(7)26(32)8;;/h17-20,27-28,37H,9-16,21-22H2,1-8H3;;/q;+1;-1 |
| InChIKey | OEZKPNLCDANWGA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|