C27H40LiO2P — CID 173244723
lithium;(4-tert-butylphenyl)-[4-(2-ethylhexoxy)-2,6-dimethylphenyl]phosphanylmethanone;hydride (PubChem CID 173244723) has the molecular formula C27H40LiO2P and a molecular weight of 434.53 g/mol. Its IUPAC name is lithium;(4-tert-butylphenyl)-[4-(2-ethylhexoxy)-2,6-dimethylphenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(4-tert-butylphenyl)-[4-(2-ethylhexoxy)-2,6-dimethylphenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173244723 |
| Molecular Formula | C27H40LiO2P |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | lithium;(4-tert-butylphenyl)-[4-(2-ethylhexoxy)-2,6-dimethylphenyl]phosphanylmethanone;hydride |
| SMILES | CCCCC(CC)COc1cc(C)c(PC(=O)c2ccc(C(C)(C)C)cc2)c(C)c1.[H-].[Li+] |
| InChI | InChI=1S/C27H39O2P.Li.H/c1-8-10-11-21(9-2)18-29-24-16-19(3)25(20(4)17-24)30-26(28)22-12-14-23(15-13-22)27(5,6)7;;/h12-17,21,30H,8-11,18H2,1-7H3;;/q;+1;-1 |
| InChIKey | SSOBVEQDIWMBQD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|