C20H26LiOP — CID 173245844
lithium;(4-tert-butylphenyl)-(2,4,6-trimethylphenyl)phosphanylmethanone;hydride (PubChem CID 173245844) has the molecular formula C20H26LiOP and a molecular weight of 320.34 g/mol. Its IUPAC name is lithium;(4-tert-butylphenyl)-(2,4,6-trimethylphenyl)phosphanylmethanone;hydride.
| Compound Name | lithium;(4-tert-butylphenyl)-(2,4,6-trimethylphenyl)phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173245844 |
| Molecular Formula | C20H26LiOP |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | lithium;(4-tert-butylphenyl)-(2,4,6-trimethylphenyl)phosphanylmethanone;hydride |
| SMILES | Cc1cc(C)c(PC(=O)c2ccc(C(C)(C)C)cc2)c(C)c1.[H-].[Li+] |
| InChI | InChI=1S/C20H25OP.Li.H/c1-13-11-14(2)18(15(3)12-13)22-19(21)16-7-9-17(10-8-16)20(4,5)6;;/h7-12,22H,1-6H3;;/q;+1;-1 |
| InChIKey | TYXBKKQLQZANFF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|