C16H26N2O2 — CID 81277300
4-(2-ethylhexoxy)-N'-hydroxy-2-methylbenzenecarboximidamide (PubChem CID 81277300) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-(2-ethylhexoxy)-N'-hydroxy-2-methylbenzenecarboximidamide.
| Compound Name | 4-(2-ethylhexoxy)-N'-hydroxy-2-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 81277300 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 4-(2-ethylhexoxy)-N'-hydroxy-2-methylbenzenecarboximidamide |
| SMILES | CCCCC(CC)COc1ccc(/C(N)=N/O)c(C)c1 |
| InChI | InChI=1S/C16H26N2O2/c1-4-6-7-13(5-2)11-20-14-8-9-15(12(3)10-14)16(17)18-19/h8-10,13,19H,4-7,11H2,1-3H3,(H2,17,18) |
| InChIKey | JICDJKZFIHCFOS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|