C39H53N3O5 — CID 136638093
N-[amino-(4-methoxyphenyl)methylidene]-4-(2-ethylhexoxy)-N'-[1-[4-(2-ethylhexoxy)-2-hydroxyphenyl]ethenyl]-2-hydroxybenzenecarboximidamide (PubChem CID 136638093) has the molecular formula C39H53N3O5 and a molecular weight of 643.87 g/mol. Its IUPAC name is N-[amino-(4-methoxyphenyl)methylidene]-4-(2-ethylhexoxy)-N'-[1-[4-(2-ethylhexoxy)-2-hydroxyphenyl]ethenyl]-2-hydroxybenzenecarboximidamide.
| Compound Name | N-[amino-(4-methoxyphenyl)methylidene]-4-(2-ethylhexoxy)-N'-[1-[4-(2-ethylhexoxy)-2-hydroxyphenyl]ethenyl]-2-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 136638093 |
| Molecular Formula | C39H53N3O5 |
| Molecular Weight | 643.87 g/mol |
| Exact Mass | 643.40 |
| IUPAC Name | N-[amino-(4-methoxyphenyl)methylidene]-4-(2-ethylhexoxy)-N'-[1-[4-(2-ethylhexoxy)-2-hydroxyphenyl]ethenyl]-2-hydroxybenzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/N)c1ccc(OC)cc1)c1ccc(OCC(CC)CCCC)cc1O)c1ccc(OCC(CC)CCCC)cc1O |
| InChI | InChI=1S/C39H53N3O5/c1-7-11-13-28(9-3)25-46-32-19-21-34(36(43)23-32)27(5)41-39(42-38(40)30-15-17-31(45-6)18-16-30)35-22-20-33(24-37(35)44)47-26-29(10-4)14-12-8-2/h15-24,28-29,43-44H,5,7-14,25-26H2,1-4,6H3,(H2,40,41,42) |
| InChIKey | NPFJMTNBOPRUNL-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.87 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|