C43H56N4O3 — CID 143243596
4-(2-ethylhexoxy)-N'-[1-[4-(2-ethylhexoxy)-2-hydroxyphenyl]ethenyl]-2-methyl-N-[1-(2-phenylpyrazol-3-yl)ethylidene]benzenecarboximidamide (PubChem CID 143243596) has the molecular formula C43H56N4O3 and a molecular weight of 676.95 g/mol. Its IUPAC name is 4-(2-ethylhexoxy)-N'-[1-[4-(2-ethylhexoxy)-2-hydroxyphenyl]ethenyl]-2-methyl-N-[1-(2-phenylpyrazol-3-yl)ethylidene]benzenecarboximidamide.
| Compound Name | 4-(2-ethylhexoxy)-N'-[1-[4-(2-ethylhexoxy)-2-hydroxyphenyl]ethenyl]-2-methyl-N-[1-(2-phenylpyrazol-3-yl)ethylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 143243596 |
| Molecular Formula | C43H56N4O3 |
| Molecular Weight | 676.95 g/mol |
| Exact Mass | 676.44 |
| IUPAC Name | 4-(2-ethylhexoxy)-N'-[1-[4-(2-ethylhexoxy)-2-hydroxyphenyl]ethenyl]-2-methyl-N-[1-(2-phenylpyrazol-3-yl)ethylidene]benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccnn1-c1ccccc1)c1ccc(OCC(CC)CCCC)cc1C)c1ccc(OCC(CC)CCCC)cc1O |
| InChI | InChI=1S/C43H56N4O3/c1-8-12-17-34(10-3)29-49-37-21-23-39(31(5)27-37)43(46-33(7)41-25-26-44-47(41)36-19-15-14-16-20-36)45-32(6)40-24-22-38(28-42(40)48)50-30-35(11-4)18-13-9-2/h14-16,19-28,34-35,48H,6,8-13,17-18,29-30H2,1-5,7H3/b45-43-,46-33+ |
| InChIKey | MWDNQKNITQOTNX-JNDOBKIZSA-N |
| XLogP | 11.00 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.95 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|