C48H71N3O4 — CID 89282038
N-[amino-(4-ethylphenyl)methylidene]-2,4-bis(2-ethylhexoxy)-N'-[1-[4-(2-ethylhexoxy)-2-hydroxyphenyl]ethenyl]benzenecarboximidamide (PubChem CID 89282038) has the molecular formula C48H71N3O4 and a molecular weight of 754.11 g/mol. Its IUPAC name is N-[amino-(4-ethylphenyl)methylidene]-2,4-bis(2-ethylhexoxy)-N'-[1-[4-(2-ethylhexoxy)-2-hydroxyphenyl]ethenyl]benzenecarboximidamide.
| Compound Name | N-[amino-(4-ethylphenyl)methylidene]-2,4-bis(2-ethylhexoxy)-N'-[1-[4-(2-ethylhexoxy)-2-hydroxyphenyl]ethenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 89282038 |
| Molecular Formula | C48H71N3O4 |
| Molecular Weight | 754.11 g/mol |
| Exact Mass | 753.54 |
| IUPAC Name | N-[amino-(4-ethylphenyl)methylidene]-2,4-bis(2-ethylhexoxy)-N'-[1-[4-(2-ethylhexoxy)-2-hydroxyphenyl]ethenyl]benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/N)c1ccc(CC)cc1)c1ccc(OCC(CC)CCCC)cc1OCC(CC)CCCC)c1ccc(OCC(CC)CCCC)cc1O |
| InChI | InChI=1S/C48H71N3O4/c1-9-16-19-37(13-5)32-53-41-26-28-43(45(52)30-41)35(8)50-48(51-47(49)40-24-22-36(12-4)23-25-40)44-29-27-42(54-33-38(14-6)20-17-10-2)31-46(44)55-34-39(15-7)21-18-11-3/h22-31,37-39,52H,8-21,32-34H2,1-7H3,(H2,49,50,51) |
| InChIKey | VBBDWWBJJPWOTE-UHFFFAOYSA-N |
| XLogP | 12.56 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.11 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|