C23H26F6LiO2P — CID 173245898
lithium;[2,6-bis(trifluoromethyl)phenyl]-[4-(2-ethylhexoxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173245898) has the molecular formula C23H26F6LiO2P and a molecular weight of 486.36 g/mol. Its IUPAC name is lithium;[2,6-bis(trifluoromethyl)phenyl]-[4-(2-ethylhexoxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;[2,6-bis(trifluoromethyl)phenyl]-[4-(2-ethylhexoxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173245898 |
| Molecular Formula | C23H26F6LiO2P |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | lithium;[2,6-bis(trifluoromethyl)phenyl]-[4-(2-ethylhexoxy)phenyl]phosphanylmethanone;hydride |
| SMILES | CCCCC(CC)COc1ccc(PC(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)cc1.[H-].[Li+] |
| InChI | InChI=1S/C23H25F6O2P.Li.H/c1-3-5-7-15(4-2)14-31-16-10-12-17(13-11-16)32-21(30)20-18(22(24,25)26)8-6-9-19(20)23(27,28)29;;/h6,8-13,15,32H,3-5,7,14H2,1-2H3;;/q;+1;-1 |
| InChIKey | PTVOIORORUNQJI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|