C21H21F6O2P — CID 18513556
[2,6-bis(trifluoromethyl)phenyl]-(4-hexoxyphenyl)phosphanylmethanone (PubChem CID 18513556) has the molecular formula C21H21F6O2P and a molecular weight of 450.36 g/mol. Its IUPAC name is [2,6-bis(trifluoromethyl)phenyl]-(4-hexoxyphenyl)phosphanylmethanone.
| Compound Name | [2,6-bis(trifluoromethyl)phenyl]-(4-hexoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18513556 |
| Molecular Formula | C21H21F6O2P |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [2,6-bis(trifluoromethyl)phenyl]-(4-hexoxyphenyl)phosphanylmethanone |
| SMILES | CCCCCCOc1ccc(PC(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H21F6O2P/c1-2-3-4-5-13-29-14-9-11-15(12-10-14)30-19(28)18-16(20(22,23)24)7-6-8-17(18)21(25,26)27/h6-12,30H,2-5,13H2,1H3 |
| InChIKey | BGHMCNFNCURNSP-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|