C25H36LiO2P — CID 173244584
lithium;(4-tert-butyl-2,6-dimethylphenyl)-(4-hexoxyphenyl)phosphanylmethanone;hydride (PubChem CID 173244584) has the molecular formula C25H36LiO2P and a molecular weight of 406.48 g/mol. Its IUPAC name is lithium;(4-tert-butyl-2,6-dimethylphenyl)-(4-hexoxyphenyl)phosphanylmethanone;hydride.
| Compound Name | lithium;(4-tert-butyl-2,6-dimethylphenyl)-(4-hexoxyphenyl)phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173244584 |
| Molecular Formula | C25H36LiO2P |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | lithium;(4-tert-butyl-2,6-dimethylphenyl)-(4-hexoxyphenyl)phosphanylmethanone;hydride |
| SMILES | CCCCCCOc1ccc(PC(=O)c2c(C)cc(C(C)(C)C)cc2C)cc1.[H-].[Li+] |
| InChI | InChI=1S/C25H35O2P.Li.H/c1-7-8-9-10-15-27-21-11-13-22(14-12-21)28-24(26)23-18(2)16-20(17-19(23)3)25(4,5)6;;/h11-14,16-17,28H,7-10,15H2,1-6H3;;/q;+1;-1 |
| InChIKey | KANVFRNDVOOKAV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|