C34H53O4P — CID 18513888
(4-tert-butyl-2,6-dimethylphenyl)-(2,4,6-tripentoxyphenyl)phosphanylmethanone (PubChem CID 18513888) has the molecular formula C34H53O4P and a molecular weight of 556.77 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)-(2,4,6-tripentoxyphenyl)phosphanylmethanone.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)-(2,4,6-tripentoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18513888 |
| Molecular Formula | C34H53O4P |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.37 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)-(2,4,6-tripentoxyphenyl)phosphanylmethanone |
| SMILES | CCCCCOc1cc(OCCCCC)c(PC(=O)c2c(C)cc(C(C)(C)C)cc2C)c(OCCCCC)c1 |
| InChI | InChI=1S/C34H53O4P/c1-9-12-15-18-36-28-23-29(37-19-16-13-10-2)32(30(24-28)38-20-17-14-11-3)39-33(35)31-25(4)21-27(22-26(31)5)34(6,7)8/h21-24,39H,9-20H2,1-8H3 |
| InChIKey | IUGBRXQFWWIVBH-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|