C28H41O7P — CID 18514095
(2,4,6-tributoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone (PubChem CID 18514095) has the molecular formula C28H41O7P and a molecular weight of 520.60 g/mol. Its IUPAC name is (2,4,6-tributoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone.
| Compound Name | (2,4,6-tributoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 18514095 |
| Molecular Formula | C28H41O7P |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (2,4,6-tributoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
| SMILES | CCCCOc1cc(OCCCC)c(PC(=O)c2c(OC)cc(OC)cc2OC)c(OCCCC)c1 |
| InChI | InChI=1S/C28H41O7P/c1-7-10-13-33-21-18-24(34-14-11-8-2)27(25(19-21)35-15-12-9-3)36-28(29)26-22(31-5)16-20(30-4)17-23(26)32-6/h16-19,36H,7-15H2,1-6H3 |
| InChIKey | BRFGUMHBIINHHS-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|