C25H35O10P — CID 18514236
(2,4,6-trimethoxyphenyl)-[2,4,6-tris(1-methoxyethoxy)phenyl]phosphanylmethanone (PubChem CID 18514236) has the molecular formula C25H35O10P and a molecular weight of 526.52 g/mol. Its IUPAC name is (2,4,6-trimethoxyphenyl)-[2,4,6-tris(1-methoxyethoxy)phenyl]phosphanylmethanone.
| Compound Name | (2,4,6-trimethoxyphenyl)-[2,4,6-tris(1-methoxyethoxy)phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 18514236 |
| Molecular Formula | C25H35O10P |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | (2,4,6-trimethoxyphenyl)-[2,4,6-tris(1-methoxyethoxy)phenyl]phosphanylmethanone |
| SMILES | COc1cc(OC)c(C(=O)Pc2c(OC(C)OC)cc(OC(C)OC)cc2OC(C)OC)c(OC)c1 |
| InChI | InChI=1S/C25H35O10P/c1-14(27-4)33-18-12-21(34-15(2)28-5)24(22(13-18)35-16(3)29-6)36-25(26)23-19(31-8)10-17(30-7)11-20(23)32-9/h10-16,36H,1-9H3 |
| InChIKey | QJXQPJPZUDBCFH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|