C26H37ClLiO8P — CID 173243351
lithium;(2-chloro-6-methoxyphenyl)-[2,4,6-tris(1-ethoxyethoxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173243351) has the molecular formula C26H37ClLiO8P and a molecular weight of 550.94 g/mol. Its IUPAC name is lithium;(2-chloro-6-methoxyphenyl)-[2,4,6-tris(1-ethoxyethoxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2-chloro-6-methoxyphenyl)-[2,4,6-tris(1-ethoxyethoxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173243351 |
| Molecular Formula | C26H37ClLiO8P |
| Molecular Weight | 550.94 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | lithium;(2-chloro-6-methoxyphenyl)-[2,4,6-tris(1-ethoxyethoxy)phenyl]phosphanylmethanone;hydride |
| SMILES | CCOC(C)Oc1cc(OC(C)OCC)c(PC(=O)c2c(Cl)cccc2OC)c(OC(C)OCC)c1.[H-].[Li+] |
| InChI | InChI=1S/C26H36ClO8P.Li.H/c1-8-30-16(4)33-19-14-22(34-17(5)31-9-2)25(23(15-19)35-18(6)32-10-3)36-26(28)24-20(27)12-11-13-21(24)29-7;;/h11-18,36H,8-10H2,1-7H3;;/q;+1;-1 |
| InChIKey | RVYAPYGWVHWYIW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.94 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|