C27H40LiO9P — CID 173245941
lithium;(2,6-dimethoxyphenyl)-[2,4,6-tris(1-ethoxyethoxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173245941) has the molecular formula C27H40LiO9P and a molecular weight of 546.52 g/mol. Its IUPAC name is lithium;(2,6-dimethoxyphenyl)-[2,4,6-tris(1-ethoxyethoxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2,6-dimethoxyphenyl)-[2,4,6-tris(1-ethoxyethoxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173245941 |
| Molecular Formula | C27H40LiO9P |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | lithium;(2,6-dimethoxyphenyl)-[2,4,6-tris(1-ethoxyethoxy)phenyl]phosphanylmethanone;hydride |
| SMILES | CCOC(C)Oc1cc(OC(C)OCC)c(PC(=O)c2c(OC)cccc2OC)c(OC(C)OCC)c1.[H-].[Li+] |
| InChI | InChI=1S/C27H39O9P.Li.H/c1-9-31-17(4)34-20-15-23(35-18(5)32-10-2)26(24(16-20)36-19(6)33-11-3)37-27(28)25-21(29-7)13-12-14-22(25)30-8;;/h12-19,37H,9-11H2,1-8H3;;/q;+1;-1 |
| InChIKey | IMTVTNOTUQOAEB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|