C21H27O7P — CID 18514415
[2,4-bis(1-methoxyethoxy)phenyl]phosphanyl-(2,6-dimethoxyphenyl)methanone (PubChem CID 18514415) has the molecular formula C21H27O7P and a molecular weight of 422.41 g/mol. Its IUPAC name is [2,4-bis(1-methoxyethoxy)phenyl]phosphanyl-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [2,4-bis(1-methoxyethoxy)phenyl]phosphanyl-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 18514415 |
| Molecular Formula | C21H27O7P |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | [2,4-bis(1-methoxyethoxy)phenyl]phosphanyl-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)Pc1ccc(OC(C)OC)cc1OC(C)OC |
| InChI | InChI=1S/C21H27O7P/c1-13(23-3)27-15-10-11-19(18(12-15)28-14(2)24-4)29-21(22)20-16(25-5)8-7-9-17(20)26-6/h7-14,29H,1-6H3 |
| InChIKey | DCVXGAWGERSWDS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|