C24H33LiO8P+ — CID 18513827
lithium [2,4-bis(1-ethoxyethoxy)phenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone (PubChem CID 18513827) has the molecular formula C24H33LiO8P+ and a molecular weight of 487.44 g/mol. Its IUPAC name is lithium [2,4-bis(1-ethoxyethoxy)phenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone.
| Compound Name | lithium [2,4-bis(1-ethoxyethoxy)phenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 18513827 |
| Molecular Formula | C24H33LiO8P+ |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | lithium [2,4-bis(1-ethoxyethoxy)phenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
| SMILES | CCOC(C)Oc1ccc(PC(=O)c2c(OC)cc(OC)cc2OC)c(OC(C)OCC)c1.[Li+] |
| InChI | InChI=1S/C24H33O8P.Li/c1-8-29-15(3)31-17-10-11-22(19(12-17)32-16(4)30-9-2)33-24(25)23-20(27-6)13-18(26-5)14-21(23)28-7;/h10-16,33H,8-9H2,1-7H3;/q;+1 |
| InChIKey | PAMUJMYPSWSHDU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|